C11H10O5 — CID 70423170
(7-methoxy-2H-chromen-3-yl) hydrogen carbonate (PubChem CID 70423170) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is (7-methoxy-2H-chromen-3-yl) hydrogen carbonate.
| Compound Name | (7-methoxy-2H-chromen-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70423170 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (7-methoxy-2H-chromen-3-yl) hydrogen carbonate |
| SMILES | COc1ccc2c(c1)OCC(OC(=O)O)=C2 |
| InChI | InChI=1S/C11H10O5/c1-14-8-3-2-7-4-9(16-11(12)13)6-15-10(7)5-8/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | XAXZFIUGDHAPEJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |