C12H9F3O4 — CID 124673363
(2R)-7-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 124673363) has the molecular formula C12H9F3O4 and a molecular weight of 274.19 g/mol. Its IUPAC name is (2R)-7-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | (2R)-7-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 124673363 |
| Molecular Formula | C12H9F3O4 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (2R)-7-methoxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | COc1ccc2c(c1)O[C@@H](C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C12H9F3O4/c1-18-7-3-2-6-4-8(11(16)17)10(12(13,14)15)19-9(6)5-7/h2-5,10H,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | LQHCCNCEUMSNGI-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |