C20H15F3O6 — CID 87889434
7-(2-ethoxy-4-formylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 87889434) has the molecular formula C20H15F3O6 and a molecular weight of 408.33 g/mol. Its IUPAC name is 7-(2-ethoxy-4-formylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-(2-ethoxy-4-formylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 87889434 |
| Molecular Formula | C20H15F3O6 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 7-(2-ethoxy-4-formylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCOc1cc(C=O)ccc1Oc1ccc2c(c1)OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C20H15F3O6/c1-2-27-17-7-11(10-24)3-6-15(17)28-13-5-4-12-8-14(19(25)26)18(20(21,22)23)29-16(12)9-13/h3-10,18H,2H2,1H3,(H,25,26) |
| InChIKey | VFMBHHOFSXUGAO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|