C15H17F3O4 — CID 142947320
ethane;6-ethyl-7-hydroxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 142947320) has the molecular formula C15H17F3O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is ethane;6-ethyl-7-hydroxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | ethane;6-ethyl-7-hydroxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 142947320 |
| Molecular Formula | C15H17F3O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | ethane;6-ethyl-7-hydroxy-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CC.CCc1cc2c(cc1O)OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C13H11F3O4.C2H6/c1-2-6-3-7-4-8(12(18)19)11(13(14,15)16)20-10(7)5-9(6)17;1-2/h3-5,11,17H,2H2,1H3,(H,18,19);1-2H3 |
| InChIKey | SJBBIUMHHXGLRK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |