C21H26ClF3O3 — CID 142947240
6-chloro-7-(2-cyclohexylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane (PubChem CID 142947240) has the molecular formula C21H26ClF3O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is 6-chloro-7-(2-cyclohexylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane.
| Compound Name | 6-chloro-7-(2-cyclohexylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142947240 |
| Molecular Formula | C21H26ClF3O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 6-chloro-7-(2-cyclohexylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane |
| SMILES | CC.O=C(O)C1=Cc2cc(Cl)c(CCC3CCCCC3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C19H20ClF3O3.C2H6/c20-15-9-13-8-14(18(24)25)17(19(21,22)23)26-16(13)10-12(15)7-6-11-4-2-1-3-5-11;1-2/h8-11,17H,1-7H2,(H,24,25);1-2H3 |
| InChIKey | UWIYWCHOLRTNAB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |