C15H13ClF3NO3 — CID 58934895
6-chloro-7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934895) has the molecular formula C15H13ClF3NO3 and a molecular weight of 347.72 g/mol. Its IUPAC name is 6-chloro-7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934895 |
| Molecular Formula | C15H13ClF3NO3 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 6-chloro-7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)c(N3CCCC3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C15H13ClF3NO3/c16-10-6-8-5-9(14(21)22)13(15(17,18)19)23-12(8)7-11(10)20-3-1-2-4-20/h5-7,13H,1-4H2,(H,21,22) |
| InChIKey | PUMXISKYLILKHR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|