C14H12ClF3O3 — CID 10471276
6-chloro-7-propan-2-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 10471276) has the molecular formula C14H12ClF3O3 and a molecular weight of 320.69 g/mol. Its IUPAC name is 6-chloro-7-propan-2-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-propan-2-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 10471276 |
| Molecular Formula | C14H12ClF3O3 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 6-chloro-7-propan-2-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1Cl)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C14H12ClF3O3/c1-6(2)8-5-11-7(4-10(8)15)3-9(13(19)20)12(21-11)14(16,17)18/h3-6,12H,1-2H3,(H,19,20) |
| InChIKey | YLFNWMQTBJLEDF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |