C18H20ClF3O3 — CID 11188066
(2R)-6-chloro-7-(2-methylhexan-2-yl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11188066) has the molecular formula C18H20ClF3O3 and a molecular weight of 376.80 g/mol. Its IUPAC name is (2R)-6-chloro-7-(2-methylhexan-2-yl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | (2R)-6-chloro-7-(2-methylhexan-2-yl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11188066 |
| Molecular Formula | C18H20ClF3O3 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2R)-6-chloro-7-(2-methylhexan-2-yl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCCC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)O)[C@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C18H20ClF3O3/c1-4-5-6-17(2,3)12-9-14-10(8-13(12)19)7-11(16(23)24)15(25-14)18(20,21)22/h7-9,15H,4-6H2,1-3H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | YOZPZRRDUOEUDL-OAHLLOKOSA-N |
| XLogP | 5.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |