C13H9BrClF3O3 — CID 151572709
7-(2-bromoethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 151572709) has the molecular formula C13H9BrClF3O3 and a molecular weight of 385.56 g/mol. Its IUPAC name is 7-(2-bromoethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-(2-bromoethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 151572709 |
| Molecular Formula | C13H9BrClF3O3 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 7-(2-bromoethyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)c(CCBr)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C13H9BrClF3O3/c14-2-1-6-5-10-7(4-9(6)15)3-8(12(19)20)11(21-10)13(16,17)18/h3-5,11H,1-2H2,(H,19,20) |
| InChIKey | QEUCKNCQAWRRIP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|