C14H10ClF3O3 — CID 58934979
6-chloro-7-cyclopropyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934979) has the molecular formula C14H10ClF3O3 and a molecular weight of 318.68 g/mol. Its IUPAC name is 6-chloro-7-cyclopropyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-cyclopropyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934979 |
| Molecular Formula | C14H10ClF3O3 |
| Molecular Weight | 318.68 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 6-chloro-7-cyclopropyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)c(C3CC3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C14H10ClF3O3/c15-10-4-7-3-9(13(19)20)12(14(16,17)18)21-11(7)5-8(10)6-1-2-6/h3-6,12H,1-2H2,(H,19,20) |
| InChIKey | LOXKAIMHLLHOLR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |