C20H18ClF3O3 — CID 142947310
7-benzyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane (PubChem CID 142947310) has the molecular formula C20H18ClF3O3 and a molecular weight of 398.81 g/mol. Its IUPAC name is 7-benzyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane.
| Compound Name | 7-benzyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142947310 |
| Molecular Formula | C20H18ClF3O3 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 7-benzyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane |
| SMILES | CC.O=C(O)C1=Cc2cc(Cl)c(Cc3ccccc3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C18H12ClF3O3.C2H6/c19-14-8-12-7-13(17(23)24)16(18(20,21)22)25-15(12)9-11(14)6-10-4-2-1-3-5-10;1-2/h1-5,7-9,16H,6H2,(H,23,24);1-2H3 |
| InChIKey | KMEZDTLESBVFHE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |