C19H13Cl2F3O4 — CID 11177988
6-chloro-7-(2-chloro-4-ethylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11177988) has the molecular formula C19H13Cl2F3O4 and a molecular weight of 433.21 g/mol. Its IUPAC name is 6-chloro-7-(2-chloro-4-ethylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-(2-chloro-4-ethylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11177988 |
| Molecular Formula | C19H13Cl2F3O4 |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 6-chloro-7-(2-chloro-4-ethylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCc1ccc(Oc2cc3c(cc2Cl)C=C(C(=O)O)C(C(F)(F)F)O3)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl2F3O4/c1-2-9-3-4-14(12(20)5-9)27-16-8-15-10(7-13(16)21)6-11(18(25)26)17(28-15)19(22,23)24/h3-8,17H,2H2,1H3,(H,25,26) |
| InChIKey | FGUXMRJNRGLXKE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |