C19H14ClF3O5 — CID 11327472
6-chloro-7-(2-methoxy-4-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11327472) has the molecular formula C19H14ClF3O5 and a molecular weight of 414.76 g/mol. Its IUPAC name is 6-chloro-7-(2-methoxy-4-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-(2-methoxy-4-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11327472 |
| Molecular Formula | C19H14ClF3O5 |
| Molecular Weight | 414.76 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 6-chloro-7-(2-methoxy-4-methylphenoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | COc1cc(C)ccc1Oc1cc2c(cc1Cl)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H14ClF3O5/c1-9-3-4-13(16(5-9)26-2)27-15-8-14-10(7-12(15)20)6-11(18(24)25)17(28-14)19(21,22)23/h3-8,17H,1-2H3,(H,24,25) |
| InChIKey | HVLOIJZKHZBNPW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.76 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |