C16H16ClF3O3 — CID 142650160
6-chloro-7-pentyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 142650160) has the molecular formula C16H16ClF3O3 and a molecular weight of 348.75 g/mol. Its IUPAC name is 6-chloro-7-pentyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-pentyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 142650160 |
| Molecular Formula | C16H16ClF3O3 |
| Molecular Weight | 348.75 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 6-chloro-7-pentyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCCCc1cc2c(cc1Cl)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C16H16ClF3O3/c1-2-3-4-5-9-8-13-10(7-12(9)17)6-11(15(21)22)14(23-13)16(18,19)20/h6-8,14H,2-5H2,1H3,(H,21,22) |
| InChIKey | CBUXWUPWTYBJQH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.75 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|