C19H23ClF3NO3 — CID 142947346
6-chloro-7-[2-methyl-1-(propylamino)butan-2-yl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 142947346) has the molecular formula C19H23ClF3NO3 and a molecular weight of 405.84 g/mol. Its IUPAC name is 6-chloro-7-[2-methyl-1-(propylamino)butan-2-yl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-[2-methyl-1-(propylamino)butan-2-yl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 142947346 |
| Molecular Formula | C19H23ClF3NO3 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 6-chloro-7-[2-methyl-1-(propylamino)butan-2-yl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCCNCC(C)(CC)c1cc2c(cc1Cl)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H23ClF3NO3/c1-4-6-24-10-18(3,5-2)13-9-15-11(8-14(13)20)7-12(17(25)26)16(27-15)19(21,22)23/h7-9,16,24H,4-6,10H2,1-3H3,(H,25,26) |
| InChIKey | ZBSQPTTWULAMHT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|