C15H16ClF3O3 — CID 142971023
6-chloro-7-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane (PubChem CID 142971023) has the molecular formula C15H16ClF3O3 and a molecular weight of 336.74 g/mol. Its IUPAC name is 6-chloro-7-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane.
| Compound Name | 6-chloro-7-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142971023 |
| Molecular Formula | C15H16ClF3O3 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 6-chloro-7-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;ethane |
| SMILES | CC.CCc1cc2c(cc1Cl)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C13H10ClF3O3.C2H6/c1-2-6-5-10-7(4-9(6)14)3-8(12(18)19)11(20-10)13(15,16)17;1-2/h3-5,11H,2H2,1H3,(H,18,19);1-2H3 |
| InChIKey | SNYKUNCTZLTMDO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |