C18H17ClF3O3- — CID 58934660
6-chloro-7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 58934660) has the molecular formula C18H17ClF3O3- and a molecular weight of 373.78 g/mol. Its IUPAC name is 6-chloro-7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 6-chloro-7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 58934660 |
| Molecular Formula | C18H17ClF3O3- |
| Molecular Weight | 373.78 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 6-chloro-7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C([O-])C1=Cc2cc(Cl)c(CC3CCCCC3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C18H18ClF3O3/c19-14-8-12-7-13(17(23)24)16(18(20,21)22)25-15(12)9-11(14)6-10-4-2-1-3-5-10/h7-10,16H,1-6H2,(H,23,24)/p-1 |
| InChIKey | MWEXFLYUHOIGRJ-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |