C11H4Cl2F3O3- — CID 20601613
6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 20601613) has the molecular formula C11H4Cl2F3O3- and a molecular weight of 312.05 g/mol. Its IUPAC name is 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 20601613 |
| Molecular Formula | C11H4Cl2F3O3- |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C([O-])C1=Cc2cc(Cl)cc(Cl)c2OC1C(F)(F)F |
| InChI | InChI=1S/C11H5Cl2F3O3/c12-5-1-4-2-6(10(17)18)9(11(14,15)16)19-8(4)7(13)3-5/h1-3,9H,(H,17,18)/p-1 |
| InChIKey | ZFKBWSREWJOSSJ-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |