C14H11Cl2F3O7 — CID 162618930
1,3-dihydroperoxypropan-2-yl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 162618930) has the molecular formula C14H11Cl2F3O7 and a molecular weight of 419.14 g/mol. Its IUPAC name is 1,3-dihydroperoxypropan-2-yl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1,3-dihydroperoxypropan-2-yl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 162618930 |
| Molecular Formula | C14H11Cl2F3O7 |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 1,3-dihydroperoxypropan-2-yl (2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C(OC(COO)COO)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C14H11Cl2F3O7/c15-7-1-6-2-9(13(20)25-8(4-23-21)5-24-22)12(14(17,18)19)26-11(6)10(16)3-7/h1-3,8,12,21-22H,4-5H2/t12-/m0/s1 |
| InChIKey | MXIBAMUGUVTFCD-LBPRGKRZSA-N |
| XLogP | 3.59 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|