C15H12F8N2O9S — CID 122699728
1,3-dinitrooxypropan-2-yl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699728) has the molecular formula C15H12F8N2O9S and a molecular weight of 548.32 g/mol. Its IUPAC name is 1,3-dinitrooxypropan-2-yl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1,3-dinitrooxypropan-2-yl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699728 |
| Molecular Formula | C15H12F8N2O9S |
| Molecular Weight | 548.32 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | 1,3-dinitrooxypropan-2-yl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OC(CO[N+](=O)[O-])CO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C15H12F8N2O9S/c1-7-2-10(35(19,20,21,22)23)3-8-4-11(13(15(16,17)18)34-12(7)8)14(26)33-9(5-31-24(27)28)6-32-25(29)30/h2-4,9,13H,5-6H2,1H3 |
| InChIKey | OPEHUZILJTVBKU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|