C17H14F8N2O12S — CID 155182119
1,3-dinitrooxypropan-2-yloxycarbonyloxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182119) has the molecular formula C17H14F8N2O12S and a molecular weight of 622.35 g/mol. Its IUPAC name is 1,3-dinitrooxypropan-2-yloxycarbonyloxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1,3-dinitrooxypropan-2-yloxycarbonyloxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182119 |
| Molecular Formula | C17H14F8N2O12S |
| Molecular Weight | 622.35 g/mol |
| Exact Mass | 622.01 |
| IUPAC Name | 1,3-dinitrooxypropan-2-yloxycarbonyloxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCOC(=O)OC(CO[N+](=O)[O-])CO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C17H14F8N2O12S/c1-8-2-11(40(21,22,23,24)25)3-9-4-12(14(17(18,19)20)39-13(8)9)15(28)34-7-35-16(29)38-10(5-36-26(30)31)6-37-27(32)33/h2-4,10,14H,5-7H2,1H3/t14-/m0/s1 |
| InChIKey | NHHFWLJHUTYSOC-AWEZNQCLSA-N |
| XLogP | 4.80 |
| TPSA | 175.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.35 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|