C19H17F6NO10 — CID 155182358
[(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxymethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182358) has the molecular formula C19H17F6NO10 and a molecular weight of 533.33 g/mol. Its IUPAC name is [(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxymethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | [(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxymethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182358 |
| Molecular Formula | C19H17F6NO10 |
| Molecular Weight | 533.33 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | [(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxymethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(OC(F)(F)F)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCOC(=O)O[C@@H](C)CCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C19H17F6NO10/c1-9-5-12(36-19(23,24)25)6-11-7-13(15(18(20,21)22)35-14(9)11)16(27)31-8-32-17(28)34-10(2)3-4-33-26(29)30/h5-7,10,15H,3-4,8H2,1-2H3/t10-,15-/m0/s1 |
| InChIKey | OVKMSVWRLZBFGV-BONVTDFDSA-N |
| XLogP | 4.24 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|