C18H15F6NO10 — CID 118248615
2-nitrooxyethoxycarbonyloxymethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118248615) has the molecular formula C18H15F6NO10 and a molecular weight of 519.30 g/mol. Its IUPAC name is 2-nitrooxyethoxycarbonyloxymethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-nitrooxyethoxycarbonyloxymethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118248615 |
| Molecular Formula | C18H15F6NO10 |
| Molecular Weight | 519.30 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 2-nitrooxyethoxycarbonyloxymethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCOC(=O)OCCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C18H15F6NO10/c1-2-9-5-11(35-18(22,23)24)6-10-7-12(14(17(19,20)21)34-13(9)10)15(26)31-8-32-16(27)30-3-4-33-25(28)29/h5-7,14H,2-4,8H2,1H3/t14-/m0/s1 |
| InChIKey | UUQVSERNLWGNLT-AWEZNQCLSA-N |
| XLogP | 3.72 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|