C18H17F6NO7S — CID 122699544
2-(2-nitrooxyethylsulfanyl)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699544) has the molecular formula C18H17F6NO7S and a molecular weight of 505.39 g/mol. Its IUPAC name is 2-(2-nitrooxyethylsulfanyl)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-(2-nitrooxyethylsulfanyl)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699544 |
| Molecular Formula | C18H17F6NO7S |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | 2-(2-nitrooxyethylsulfanyl)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OCCSCCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C18H17F6NO7S/c1-2-10-7-12(32-18(22,23)24)8-11-9-13(15(17(19,20)21)31-14(10)11)16(26)29-3-5-33-6-4-30-25(27)28/h7-9,15H,2-6H2,1H3 |
| InChIKey | PKUSCLHRYQCMJX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|