C16H15F8NO6S2 — CID 122699738
2-(2-nitrooxyethylsulfanyl)ethyl (2S)-8-methyl-6-(pentafluoro-lambda6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699738) has the molecular formula C16H15F8NO6S2 and a molecular weight of 533.40 g/mol. Its IUPAC name is 2-(2-nitrooxyethylsulfanyl)ethyl (2S)-8-methyl-6-(pentafluoro-lambda6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-(2-nitrooxyethylsulfanyl)ethyl (2S)-8-methyl-6-(pentafluoro-lambda6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699738 |
| Molecular Formula | C16H15F8NO6S2 |
| Molecular Weight | 533.40 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | 2-(2-nitrooxyethylsulfanyl)ethyl (2S)-8-methyl-6-(pentafluoro-lambda6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC1=CC(=CC2=C1O[C@@H](C(=C2)C(=O)OCCSCCO[N+](=O)[O-])C(F)(F)F)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C16H15F8NO6S2/c1-9-6-11(33(20,21,22,23)24)7-10-8-12(14(16(17,18)19)31-13(9)10)15(26)29-2-4-32-5-3-30-25(27)28/h6-8,14H,2-5H2,1H3/t14-/m0/s1 |
| InChIKey | ISNIBEKFLFPYEK-AWEZNQCLSA-N |
| XLogP | 7.50 |
| TPSA | 117.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | 785 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.40 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|