C18H17F8NO9S2 — CID 155182346
1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl (2S)-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182346) has the molecular formula C18H17F8NO9S2 and a molecular weight of 607.45 g/mol. Its IUPAC name is 1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl (2S)-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl (2S)-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182346 |
| Molecular Formula | C18H17F8NO9S2 |
| Molecular Weight | 607.45 g/mol |
| Exact Mass | 607.02 |
| IUPAC Name | 1-[2-(2-nitrooxyethylsulfanyl)ethoxycarbonyloxy]ethyl (2S)-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(OC(=O)OCCSCCO[N+](=O)[O-])OC(=O)C1=Cc2cc(S(F)(F)(F)(F)F)ccc2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C18H17F8NO9S2/c1-10(35-17(29)32-4-6-37-7-5-33-27(30)31)34-16(28)13-9-11-8-12(38(22,23,24,25)26)2-3-14(11)36-15(13)18(19,20)21/h2-3,8-10,15H,4-7H2,1H3/t10?,15-/m0/s1 |
| InChIKey | BHKCZXVLSARXFZ-WRXSAAJRSA-N |
| XLogP | 6.03 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|