C16H13F6NO7 — CID 73026699
4-nitrooxybutyl 6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 73026699) has the molecular formula C16H13F6NO7 and a molecular weight of 445.27 g/mol. Its IUPAC name is 4-nitrooxybutyl 6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 4-nitrooxybutyl 6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 73026699 |
| Molecular Formula | C16H13F6NO7 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 4-nitrooxybutyl 6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C(OCCCCO[N+](=O)[O-])C1=Cc2cc(OC(F)(F)F)ccc2OC1C(F)(F)F |
| InChI | InChI=1S/C16H13F6NO7/c17-15(18,19)13-11(14(24)27-5-1-2-6-28-23(25)26)8-9-7-10(30-16(20,21)22)3-4-12(9)29-13/h3-4,7-8,13H,1-2,5-6H2 |
| InChIKey | WNNMTNBDNNNQHT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|