C20H19F6NO9 — CID 155182149
2-(4-nitrooxybutanoyloxy)ethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182149) has the molecular formula C20H19F6NO9 and a molecular weight of 531.36 g/mol. Its IUPAC name is 2-(4-nitrooxybutanoyloxy)ethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-(4-nitrooxybutanoyloxy)ethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182149 |
| Molecular Formula | C20H19F6NO9 |
| Molecular Weight | 531.36 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 2-(4-nitrooxybutanoyloxy)ethyl (2S)-8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCCOC(=O)CCCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C20H19F6NO9/c1-2-11-8-13(36-20(24,25)26)9-12-10-14(17(19(21,22)23)35-16(11)12)18(29)33-7-6-32-15(28)4-3-5-34-27(30)31/h8-10,17H,2-7H2,1H3/t17-/m0/s1 |
| InChIKey | IVQCJFIBMVDPNH-KRWDZBQOSA-N |
| XLogP | 3.93 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|