C15H12F6O4 — CID 154502126
methyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 154502126) has the molecular formula C15H12F6O4 and a molecular weight of 370.25 g/mol. Its IUPAC name is methyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | methyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 154502126 |
| Molecular Formula | C15H12F6O4 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | methyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OC)=C2 |
| InChI | InChI=1S/C15H12F6O4/c1-3-7-4-9(25-15(19,20)21)5-8-6-10(13(22)23-2)12(14(16,17)18)24-11(7)8/h4-6,12H,3H2,1-2H3 |
| InChIKey | PGEJSLVVIIWGNU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |