C15H12F6O4 — CID 138563884
ethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 138563884) has the molecular formula C15H12F6O4 and a molecular weight of 370.25 g/mol. Its IUPAC name is ethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 138563884 |
| Molecular Formula | C15H12F6O4 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | ethyl (2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(OC(F)(F)F)cc(C)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C15H12F6O4/c1-3-23-13(22)10-6-8-5-9(25-15(19,20)21)4-7(2)11(8)24-12(10)14(16,17)18/h4-6,12H,3H2,1-2H3/t12-/m0/s1 |
| InChIKey | MCDUDCYDRJTXKH-LBPRGKRZSA-N |
| XLogP | 4.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |