C16H15F6NO5 — CID 144889896
1-aminooxyethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 144889896) has the molecular formula C16H15F6NO5 and a molecular weight of 415.29 g/mol. Its IUPAC name is 1-aminooxyethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-aminooxyethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 144889896 |
| Molecular Formula | C16H15F6NO5 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 1-aminooxyethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OC(C)ON)=C2 |
| InChI | InChI=1S/C16H15F6NO5/c1-3-8-4-10(27-16(20,21)22)5-9-6-11(14(24)25-7(2)28-23)13(15(17,18)19)26-12(8)9/h4-7,13H,3,23H2,1-2H3 |
| InChIKey | WKNGNFUUTYSCDI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|