C19H15F6NO4 — CID 87870468
8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;pyridine (PubChem CID 87870468) has the molecular formula C19H15F6NO4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;pyridine.
| Compound Name | 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;pyridine |
|---|---|
| PubChem CID | 87870468 |
| Molecular Formula | C19H15F6NO4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;pyridine |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)O)=C2.c1ccncc1 |
| InChI | InChI=1S/C14H10F6O4.C5H5N/c1-2-6-3-8(24-14(18,19)20)4-7-5-9(12(21)22)11(13(15,16)17)23-10(6)7;1-2-4-6-5-3-1/h3-5,11H,2H2,1H3,(H,21,22);1-5H |
| InChIKey | GCDGHLKEEQXKDX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |