C13H8F6O5 — CID 52942642
8-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 52942642) has the molecular formula C13H8F6O5 and a molecular weight of 358.19 g/mol. Its IUPAC name is 8-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 52942642 |
| Molecular Formula | C13H8F6O5 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 8-methoxy-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | COc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C13H8F6O5/c1-22-8-4-6(24-13(17,18)19)2-5-3-7(11(20)21)10(12(14,15)16)23-9(5)8/h2-4,10H,1H3,(H,20,21) |
| InChIKey | PBGRARHEVYPEOU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |