C34H38F6O6 — CID 157276410
8-tert-butyl-6-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 157276410) has the molecular formula C34H38F6O6 and a molecular weight of 656.66 g/mol. Its IUPAC name is 8-tert-butyl-6-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-tert-butyl-6-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 157276410 |
| Molecular Formula | C34H38F6O6 |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 8-tert-butyl-6-ethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCc1cc2c(c(C(C)(C)C)c1)OC(C(F)(F)F)C(C(=O)O)=C2.CCc1cc2c(c(C(C)(C)C)c1)OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/2C17H19F3O3/c2*1-5-9-6-10-8-11(15(21)22)14(17(18,19)20)23-13(10)12(7-9)16(2,3)4/h2*6-8,14H,5H2,1-4H3,(H,21,22) |
| InChIKey | AZDQEXZPHGRFFH-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |