C12H8BrF3O3 — CID 58934890
6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934890) has the molecular formula C12H8BrF3O3 and a molecular weight of 337.09 g/mol. Its IUPAC name is 6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934890 |
| Molecular Formula | C12H8BrF3O3 |
| Molecular Weight | 337.09 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | Cc1cc(Br)cc2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C12H8BrF3O3/c1-5-2-7(13)3-6-4-8(11(17)18)10(12(14,15)16)19-9(5)6/h2-4,10H,1H3,(H,17,18) |
| InChIKey | ILHUJLLYTPMLPK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |