C14H14ClF3O3Si — CID 71731734
8-chloro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylic acid (PubChem CID 71731734) has the molecular formula C14H14ClF3O3Si and a molecular weight of 350.80 g/mol. Its IUPAC name is 8-chloro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylic acid.
| Compound Name | 8-chloro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 71731734 |
| Molecular Formula | C14H14ClF3O3Si |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 8-chloro-2-(trifluoromethyl)-6-trimethylsilyl-2H-chromene-3-carboxylic acid |
| SMILES | C[Si](C)(C)c1cc(Cl)c2c(c1)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C14H14ClF3O3Si/c1-22(2,3)8-4-7-5-9(13(19)20)12(14(16,17)18)21-11(7)10(15)6-8/h4-6,12H,1-3H3,(H,19,20) |
| InChIKey | JNPXRYNFQHCWLW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|