C13H10F8O3S — CID 118222220
8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 118222220) has the molecular formula C13H10F8O3S and a molecular weight of 398.27 g/mol. Its IUPAC name is 8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 118222220 |
| Molecular Formula | C13H10F8O3S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CCc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C13H10F8O3S/c1-2-6-3-8(25(17,18,19,20)21)4-7-5-9(12(22)23)11(13(14,15)16)24-10(6)7/h3-5,11H,2H2,1H3,(H,22,23) |
| InChIKey | LFEYXCXOYJHQMW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |