C13H9F8O3S- — CID 154343038
8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 154343038) has the molecular formula C13H9F8O3S- and a molecular weight of 397.26 g/mol. Its IUPAC name is 8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 154343038 |
| Molecular Formula | C13H9F8O3S- |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 8-ethyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)[O-])=C2 |
| InChI | InChI=1S/C13H10F8O3S/c1-2-6-3-8(25(17,18,19,20)21)4-7-5-9(12(22)23)11(13(14,15)16)24-10(6)7/h3-5,11H,2H2,1H3,(H,22,23)/p-1 |
| InChIKey | LFEYXCXOYJHQMW-UHFFFAOYSA-M |
| XLogP | 4.36 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |