C15H11F8NO8S — CID 122699665
(2-nitrooxyacetyl)oxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699665) has the molecular formula C15H11F8NO8S and a molecular weight of 517.30 g/mol. Its IUPAC name is (2-nitrooxyacetyl)oxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | (2-nitrooxyacetyl)oxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699665 |
| Molecular Formula | C15H11F8NO8S |
| Molecular Weight | 517.30 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | (2-nitrooxyacetyl)oxymethyl (2S)-8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCOC(=O)CO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C15H11F8NO8S/c1-7-2-9(33(19,20,21,22)23)3-8-4-10(13(15(16,17)18)32-12(7)8)14(26)30-6-29-11(25)5-31-24(27)28/h2-4,13H,5-6H2,1H3/t13-/m0/s1 |
| InChIKey | RGKFOQDBYBCVJJ-ZDUSSCGKSA-N |
| XLogP | 4.61 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|