C17H18F8N2O6S — CID 122699907
2-[methyl(2-nitrooxyethyl)amino]ethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699907) has the molecular formula C17H18F8N2O6S and a molecular weight of 530.39 g/mol. Its IUPAC name is 2-[methyl(2-nitrooxyethyl)amino]ethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-[methyl(2-nitrooxyethyl)amino]ethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699907 |
| Molecular Formula | C17H18F8N2O6S |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 2-[methyl(2-nitrooxyethyl)amino]ethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OCCN(C)CCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C17H18F8N2O6S/c1-10-7-12(34(21,22,23,24)25)8-11-9-13(15(17(18,19)20)33-14(10)11)16(28)31-5-3-26(2)4-6-32-27(29)30/h7-9,15H,3-6H2,1-2H3 |
| InChIKey | MJHKXKULMWNPLL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|