C19H19F8NO9S — CID 155657636
1-[(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxyethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155657636) has the molecular formula C19H19F8NO9S and a molecular weight of 589.41 g/mol. Its IUPAC name is 1-[(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxyethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-[(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxyethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155657636 |
| Molecular Formula | C19H19F8NO9S |
| Molecular Weight | 589.41 g/mol |
| Exact Mass | 589.07 |
| IUPAC Name | 1-[(2S)-4-nitrooxybutan-2-yl]oxycarbonyloxyethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OC(C)OC(=O)O[C@@H](C)CCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C19H19F8NO9S/c1-9-6-13(38(23,24,25,26)27)7-12-8-14(16(19(20,21)22)37-15(9)12)17(29)35-11(3)36-18(30)34-10(2)4-5-33-28(31)32/h6-8,10-11,16H,4-5H2,1-3H3/t10-,11?,16?/m0/s1 |
| InChIKey | WOXGUCHXXFAHGM-SGWRBKMISA-N |
| XLogP | 6.39 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|