C19H20F3NO9 — CID 155182471
4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182471) has the molecular formula C19H20F3NO9 and a molecular weight of 463.36 g/mol. Its IUPAC name is 4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182471 |
| Molecular Formula | C19H20F3NO9 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(C)c2c(c1)C=C(C(=O)OCOC(=O)OC(C)CCO[N+](=O)[O-])C(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H20F3NO9/c1-10-6-11(2)15-13(7-10)8-14(16(32-15)19(20,21)22)17(24)28-9-29-18(25)31-12(3)4-5-30-23(26)27/h6-8,12,16H,4-5,9H2,1-3H3 |
| InChIKey | UIKZNSQHVMZWDB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|