C20H22F3NO9 — CID 155182293
(2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl (2S)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182293) has the molecular formula C20H22F3NO9 and a molecular weight of 477.39 g/mol. Its IUPAC name is (2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl (2S)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | (2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl (2S)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182293 |
| Molecular Formula | C20H22F3NO9 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | (2,2-dimethyl-3-nitrooxypropoxy)carbonyloxymethyl (2S)-6,8-dimethyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(C)c2c(c1)C=C(C(=O)OCOC(=O)OCC(C)(C)CO[N+](=O)[O-])[C@@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C20H22F3NO9/c1-11-5-12(2)15-13(6-11)7-14(16(33-15)20(21,22)23)17(25)30-10-31-18(26)29-8-19(3,4)9-32-24(27)28/h5-7,16H,8-10H2,1-4H3/t16-/m0/s1 |
| InChIKey | ZFIDTFFSRIJCDX-INIZCTEOSA-N |
| XLogP | 3.90 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|