C17H15ClF3NO9 — CID 118248676
2-nitrooxypropoxycarbonyloxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118248676) has the molecular formula C17H15ClF3NO9 and a molecular weight of 469.75 g/mol. Its IUPAC name is 2-nitrooxypropoxycarbonyloxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-nitrooxypropoxycarbonyloxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118248676 |
| Molecular Formula | C17H15ClF3NO9 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | 2-nitrooxypropoxycarbonyloxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(Cl)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCOC(=O)OCC(C)O[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C17H15ClF3NO9/c1-8-3-11(18)4-10-5-12(14(17(19,20)21)30-13(8)10)15(23)28-7-29-16(24)27-6-9(2)31-22(25)26/h3-5,9,14H,6-7H2,1-2H3/t9?,14-/m0/s1 |
| InChIKey | WGCGGZDJMXGONJ-RJSPSEDBSA-N |
| XLogP | 3.61 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|