C17H14Cl2F3NO9 — CID 155182419
4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182419) has the molecular formula C17H14Cl2F3NO9 and a molecular weight of 504.20 g/mol. Its IUPAC name is 4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182419 |
| Molecular Formula | C17H14Cl2F3NO9 |
| Molecular Weight | 504.20 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | 4-nitrooxybutan-2-yloxycarbonyloxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(CCO[N+](=O)[O-])OC(=O)OCOC(=O)C1=Cc2cc(Cl)cc(Cl)c2OC1C(F)(F)F |
| InChI | InChI=1S/C17H14Cl2F3NO9/c1-8(2-3-30-23(26)27)31-16(25)29-7-28-15(24)11-5-9-4-10(18)6-12(19)13(9)32-14(11)17(20,21)22/h4-6,8,14H,2-3,7H2,1H3 |
| InChIKey | WVJBRDSKUJXFRV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.20 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|