C18H16Cl2F3NO9 — CID 155182357
1-(4-nitrooxybutan-2-yloxycarbonyloxy)ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182357) has the molecular formula C18H16Cl2F3NO9 and a molecular weight of 518.22 g/mol. Its IUPAC name is 1-(4-nitrooxybutan-2-yloxycarbonyloxy)ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-(4-nitrooxybutan-2-yloxycarbonyloxy)ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182357 |
| Molecular Formula | C18H16Cl2F3NO9 |
| Molecular Weight | 518.22 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 1-(4-nitrooxybutan-2-yloxycarbonyloxy)ethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(CCO[N+](=O)[O-])OC(=O)OC(C)OC(=O)C1=Cc2cc(Cl)cc(Cl)c2OC1C(F)(F)F |
| InChI | InChI=1S/C18H16Cl2F3NO9/c1-8(3-4-29-24(27)28)30-17(26)32-9(2)31-16(25)12-6-10-5-11(19)7-13(20)14(10)33-15(12)18(21,22)23/h5-9,15H,3-4H2,1-2H3 |
| InChIKey | DTNHPNRXDLIEKO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|