C21H21F6NO10 — CID 155182452
1-(3-nitrooxybutoxycarbonyloxy)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182452) has the molecular formula C21H21F6NO10 and a molecular weight of 561.38 g/mol. Its IUPAC name is 1-(3-nitrooxybutoxycarbonyloxy)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-(3-nitrooxybutoxycarbonyloxy)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182452 |
| Molecular Formula | C21H21F6NO10 |
| Molecular Weight | 561.38 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | 1-(3-nitrooxybutoxycarbonyloxy)ethyl 8-ethyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OC(C)OC(=O)OCCC(C)O[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C21H21F6NO10/c1-4-12-7-14(37-21(25,26)27)8-13-9-15(17(20(22,23)24)36-16(12)13)18(29)34-11(3)35-19(30)33-6-5-10(2)38-28(31)32/h7-11,17H,4-6H2,1-3H3 |
| InChIKey | JSSNIUCYFQBJEI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|