C21H21F6NO10 — CID 155182058
1-(2,2-dimethyl-3-nitrooxypropoxy)carbonyloxyethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182058) has the molecular formula C21H21F6NO10 and a molecular weight of 561.38 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-nitrooxypropoxy)carbonyloxyethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-(2,2-dimethyl-3-nitrooxypropoxy)carbonyloxyethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182058 |
| Molecular Formula | C21H21F6NO10 |
| Molecular Weight | 561.38 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | 1-(2,2-dimethyl-3-nitrooxypropoxy)carbonyloxyethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OC(C)OC(=O)OCC(C)(C)CO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C21H21F6NO10/c1-10-5-13(38-21(25,26)27)6-12-7-14(16(20(22,23)24)37-15(10)12)17(29)35-11(2)36-18(30)33-8-19(3,4)9-34-28(31)32/h5-7,11,16H,8-9H2,1-4H3 |
| InChIKey | PVLFHTDTIQMQRF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|