C17H13F6NO9 — CID 155182466
3-nitrooxypropanoyloxymethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182466) has the molecular formula C17H13F6NO9 and a molecular weight of 489.28 g/mol. Its IUPAC name is 3-nitrooxypropanoyloxymethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 3-nitrooxypropanoyloxymethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182466 |
| Molecular Formula | C17H13F6NO9 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | 3-nitrooxypropanoyloxymethyl 8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(OC(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OCOC(=O)CCO[N+](=O)[O-])=C2 |
| InChI | InChI=1S/C17H13F6NO9/c1-8-4-10(33-17(21,22)23)5-9-6-11(14(16(18,19)20)32-13(8)9)15(26)30-7-29-12(25)2-3-31-24(27)28/h4-6,14H,2-3,7H2,1H3 |
| InChIKey | FHQFWBODKLOIJK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|