C22H25ClF3NO9 — CID 155182140
1-(3-nitrooxybutoxycarbonyloxy)ethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182140) has the molecular formula C22H25ClF3NO9 and a molecular weight of 539.89 g/mol. Its IUPAC name is 1-(3-nitrooxybutoxycarbonyloxy)ethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1-(3-nitrooxybutoxycarbonyloxy)ethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182140 |
| Molecular Formula | C22H25ClF3NO9 |
| Molecular Weight | 539.89 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 1-(3-nitrooxybutoxycarbonyloxy)ethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(CCOC(=O)OC(C)OC(=O)C1=Cc2cc(Cl)c(C(C)(C)C)cc2OC1C(F)(F)F)O[N+](=O)[O-] |
| InChI | InChI=1S/C22H25ClF3NO9/c1-11(36-27(30)31)6-7-32-20(29)34-12(2)33-19(28)14-8-13-9-16(23)15(21(3,4)5)10-17(13)35-18(14)22(24,25)26/h8-12,18H,6-7H2,1-5H3 |
| InChIKey | YTTZLZYQPAUTCQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.89 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|